C11H15NO4S2 — CID 113437786
5-[methyl(pent-4-enyl)sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 113437786) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 5-[methyl(pent-4-enyl)sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[methyl(pent-4-enyl)sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 113437786 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 5-[methyl(pent-4-enyl)sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | C=CCCCN(C)S(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H15NO4S2/c1-3-4-5-6-12(2)18(15,16)10-7-9(8-17-10)11(13)14/h3,7-8H,1,4-6H2,2H3,(H,13,14) |
| InChIKey | FLHPBZPBHQIJRS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|