C11H14F3NO4S2 — CID 60951577
5-[butyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 60951577) has the molecular formula C11H14F3NO4S2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 5-[butyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[butyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 60951577 |
| Molecular Formula | C11H14F3NO4S2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 5-[butyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CCCCN(CC(F)(F)F)S(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H14F3NO4S2/c1-2-3-4-15(7-11(12,13)14)21(18,19)9-5-8(6-20-9)10(16)17/h5-6H,2-4,7H2,1H3,(H,16,17) |
| InChIKey | SQMNDTJMFRAHNY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |