C12H19NO4S2 — CID 79477660
5-[ethyl(2-methylbutyl)sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 79477660) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 5-[ethyl(2-methylbutyl)sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[ethyl(2-methylbutyl)sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 79477660 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 5-[ethyl(2-methylbutyl)sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CCC(C)CN(CC)S(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H19NO4S2/c1-4-9(3)7-13(5-2)19(16,17)11-6-10(8-18-11)12(14)15/h6,8-9H,4-5,7H2,1-3H3,(H,14,15) |
| InChIKey | OHBWRVUPJWRMFT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |