C13H21NO5S — CID 79477863
4-[ethyl(2-methylbutyl)sulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 79477863) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is 4-[ethyl(2-methylbutyl)sulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[ethyl(2-methylbutyl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 79477863 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-[ethyl(2-methylbutyl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | CCC(C)CN(CC)S(=O)(=O)c1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C13H21NO5S/c1-5-9(3)8-14(6-2)20(17,18)12-7-11(13(15)16)19-10(12)4/h7,9H,5-6,8H2,1-4H3,(H,15,16) |
| InChIKey | JAXJBZBHEUHBJN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |