C12H20N2O4S — CID 79477252
4-[ethyl(2-methylbutyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 79477252) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-[ethyl(2-methylbutyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[ethyl(2-methylbutyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79477252 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-[ethyl(2-methylbutyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CCC(C)CN(CC)S(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C12H20N2O4S/c1-4-9(3)8-14(5-2)19(17,18)10-6-11(12(15)16)13-7-10/h6-7,9,13H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | WBZUYHRAOOHGHD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |