C11H12N4O4S — CID 43311208
4-[bis(2-cyanoethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 43311208) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-[bis(2-cyanoethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[bis(2-cyanoethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43311208 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-[bis(2-cyanoethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C11H12N4O4S/c12-3-1-5-15(6-2-4-13)20(18,19)9-7-10(11(16)17)14-8-9/h7-8,14H,1-2,5-6H2,(H,16,17) |
| InChIKey | KPQDDRFOXNPEOL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |