C11H20N4O3S — CID 16780236
5-(hydrazinecarbonyl)-N,N-dipropyl-1H-pyrrole-3-sulfonamide (PubChem CID 16780236) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 5-(hydrazinecarbonyl)-N,N-dipropyl-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(hydrazinecarbonyl)-N,N-dipropyl-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 16780236 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-(hydrazinecarbonyl)-N,N-dipropyl-1H-pyrrole-3-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1c[nH]c(C(=O)NN)c1 |
| InChI | InChI=1S/C11H20N4O3S/c1-3-5-15(6-4-2)19(17,18)9-7-10(13-8-9)11(16)14-12/h7-8,13H,3-6,12H2,1-2H3,(H,14,16) |
| InChIKey | WUEAWFNILVVQSS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|