C7H12N4O3S — CID 16780083
5-(hydrazinecarbonyl)-N,N-dimethyl-1H-pyrrole-3-sulfonamide (PubChem CID 16780083) has the molecular formula C7H12N4O3S and a molecular weight of 232.26 g/mol. Its IUPAC name is 5-(hydrazinecarbonyl)-N,N-dimethyl-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(hydrazinecarbonyl)-N,N-dimethyl-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 16780083 |
| Molecular Formula | C7H12N4O3S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 5-(hydrazinecarbonyl)-N,N-dimethyl-1H-pyrrole-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c[nH]c(C(=O)NN)c1 |
| InChI | InChI=1S/C7H12N4O3S/c1-11(2)15(13,14)5-3-6(9-4-5)7(12)10-8/h3-4,9H,8H2,1-2H3,(H,10,12) |
| InChIKey | OKLQNSQTDRTBDK-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|