C7H10N2O4S — CID 16780472
4-(dimethylsulfamoyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 16780472) has the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(dimethylsulfamoyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 16780472 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4-(dimethylsulfamoyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | CN(C)S(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C7H10N2O4S/c1-9(2)14(12,13)5-3-6(7(10)11)8-4-5/h3-4,8H,1-2H3,(H,10,11) |
| InChIKey | MZOGCGKXLWGCHT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |