C11H11FN4O3S — CID 16780201
N-(4-fluorophenyl)-5-(hydrazinecarbonyl)-1H-pyrrole-3-sulfonamide (PubChem CID 16780201) has the molecular formula C11H11FN4O3S and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-(hydrazinecarbonyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(4-fluorophenyl)-5-(hydrazinecarbonyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 16780201 |
| Molecular Formula | C11H11FN4O3S |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(4-fluorophenyl)-5-(hydrazinecarbonyl)-1H-pyrrole-3-sulfonamide |
| SMILES | NNC(=O)c1cc(S(=O)(=O)Nc2ccc(F)cc2)c[nH]1 |
| InChI | InChI=1S/C11H11FN4O3S/c12-7-1-3-8(4-2-7)16-20(18,19)9-5-10(14-6-9)11(17)15-13/h1-6,14,16H,13H2,(H,15,17) |
| InChIKey | YRJZXDZJYYERPJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|