C12H9FN2O6S — CID 51106121
4-[(2-carboxy-4-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 51106121) has the molecular formula C12H9FN2O6S and a molecular weight of 328.28 g/mol. Its IUPAC name is 4-[(2-carboxy-4-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(2-carboxy-4-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 51106121 |
| Molecular Formula | C12H9FN2O6S |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 4-[(2-carboxy-4-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccc(F)cc2C(=O)O)c[nH]1 |
| InChI | InChI=1S/C12H9FN2O6S/c13-6-1-2-9(8(3-6)11(16)17)15-22(20,21)7-4-10(12(18)19)14-5-7/h1-5,14-15H,(H,16,17)(H,18,19) |
| InChIKey | FXLDZWDQVJCTMA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |