C11H8F2N2O4S — CID 29051788
4-[(3,5-difluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 29051788) has the molecular formula C11H8F2N2O4S and a molecular weight of 302.26 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(3,5-difluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 29051788 |
| Molecular Formula | C11H8F2N2O4S |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-[(3,5-difluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2cc(F)cc(F)c2)c[nH]1 |
| InChI | InChI=1S/C11H8F2N2O4S/c12-6-1-7(13)3-8(2-6)15-20(18,19)9-4-10(11(16)17)14-5-9/h1-5,14-15H,(H,16,17) |
| InChIKey | CRCAPPWJIQXKHH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |