C12H8FN3O4S — CID 43580595
4-[(2-cyano-3-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 43580595) has the molecular formula C12H8FN3O4S and a molecular weight of 309.28 g/mol. Its IUPAC name is 4-[(2-cyano-3-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(2-cyano-3-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43580595 |
| Molecular Formula | C12H8FN3O4S |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 4-[(2-cyano-3-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | N#Cc1c(F)cccc1NS(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C12H8FN3O4S/c13-9-2-1-3-10(8(9)5-14)16-21(19,20)7-4-11(12(17)18)15-6-7/h1-4,6,15-16H,(H,17,18) |
| InChIKey | ISVLIOKIVWMIDN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |