C8H14N4O3S — CID 16780167
5-(hydrazinecarbonyl)-N,N,1-trimethylpyrrole-3-sulfonamide (PubChem CID 16780167) has the molecular formula C8H14N4O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is 5-(hydrazinecarbonyl)-N,N,1-trimethylpyrrole-3-sulfonamide.
| Compound Name | 5-(hydrazinecarbonyl)-N,N,1-trimethylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 16780167 |
| Molecular Formula | C8H14N4O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 5-(hydrazinecarbonyl)-N,N,1-trimethylpyrrole-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)NN)n(C)c1 |
| InChI | InChI=1S/C8H14N4O3S/c1-11(2)16(14,15)6-4-7(8(13)10-9)12(3)5-6/h4-5H,9H2,1-3H3,(H,10,13) |
| InChIKey | IUOWFMSKKFYYSY-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|