C13H22N4O3S — CID 16780041
4-(3,5-dimethylpiperidin-1-yl)sulfonyl-1-methylpyrrole-2-carbohydrazide (PubChem CID 16780041) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 16780041 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-1-methylpyrrole-2-carbohydrazide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cc(C(=O)NN)n(C)c2)C1 |
| InChI | InChI=1S/C13H22N4O3S/c1-9-4-10(2)7-17(6-9)21(19,20)11-5-12(13(18)15-14)16(3)8-11/h5,8-10H,4,6-7,14H2,1-3H3,(H,15,18) |
| InChIKey | SQUPCTZWVKYBRN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|