C14H15BrN4O4S — CID 31421387
4-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]carbamoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 31421387) has the molecular formula C14H15BrN4O4S and a molecular weight of 415.27 g/mol. Its IUPAC name is 4-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]carbamoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 31421387 |
| Molecular Formula | C14H15BrN4O4S |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 4-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NNC(=O)c2cc(Br)c[nH]2)cc1 |
| InChI | InChI=1S/C14H15BrN4O4S/c1-19(2)24(22,23)11-5-3-9(4-6-11)13(20)17-18-14(21)12-7-10(15)8-16-12/h3-8,16H,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | ARJWAVDUYGUUJD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|