C14H13BrN4O3 — CID 134029250
4-bromo-N'-[4-[(E)-methoxyiminomethyl]benzoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 134029250) has the molecular formula C14H13BrN4O3 and a molecular weight of 365.19 g/mol. Its IUPAC name is 4-bromo-N'-[4-[(E)-methoxyiminomethyl]benzoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[4-[(E)-methoxyiminomethyl]benzoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 134029250 |
| Molecular Formula | C14H13BrN4O3 |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 4-bromo-N'-[4-[(E)-methoxyiminomethyl]benzoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | CO/N=C/c1ccc(C(=O)NNC(=O)c2cc(Br)c[nH]2)cc1 |
| InChI | InChI=1S/C14H13BrN4O3/c1-22-17-7-9-2-4-10(5-3-9)13(20)18-19-14(21)12-6-11(15)8-16-12/h2-8,16H,1H3,(H,18,20)(H,19,21)/b17-7+ |
| InChIKey | ZIFPQJVHTSCFMG-REZTVBANSA-N |
| XLogP | 1.83 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|