C16H14BrN3O3 — CID 86932919
2-bromo-N'-[4-[(E)-methoxyiminomethyl]benzoyl]benzohydrazide (PubChem CID 86932919) has the molecular formula C16H14BrN3O3 and a molecular weight of 376.21 g/mol. Its IUPAC name is 2-bromo-N'-[4-[(E)-methoxyiminomethyl]benzoyl]benzohydrazide.
| Compound Name | 2-bromo-N'-[4-[(E)-methoxyiminomethyl]benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 86932919 |
| Molecular Formula | C16H14BrN3O3 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 2-bromo-N'-[4-[(E)-methoxyiminomethyl]benzoyl]benzohydrazide |
| SMILES | CO/N=C/c1ccc(C(=O)NNC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C16H14BrN3O3/c1-23-18-10-11-6-8-12(9-7-11)15(21)19-20-16(22)13-4-2-3-5-14(13)17/h2-10H,1H3,(H,19,21)(H,20,22)/b18-10+ |
| InChIKey | HGOWKKNHDIWYSU-VCHYOVAHSA-N |
| XLogP | 2.50 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|