C23H20BrN3O5 — CID 55358458
2-bromo-N-[2-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 55358458) has the molecular formula C23H20BrN3O5 and a molecular weight of 498.33 g/mol. Its IUPAC name is 2-bromo-N-[2-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-bromo-N-[2-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55358458 |
| Molecular Formula | C23H20BrN3O5 |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 2-bromo-N-[2-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccccc2NC(=O)c2ccccc2Br)cc1OC |
| InChI | InChI=1S/C23H20BrN3O5/c1-31-19-12-11-14(13-20(19)32-2)21(28)26-27-23(30)16-8-4-6-10-18(16)25-22(29)15-7-3-5-9-17(15)24/h3-13H,1-2H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | XFKPVLLYBLOOQI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|