C12H15N3O4 — CID 54475671
N-(2-amino-1-methoxy-2-oxoethyl)-4-(methoxyiminomethyl)benzamide (PubChem CID 54475671) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is N-(2-amino-1-methoxy-2-oxoethyl)-4-(methoxyiminomethyl)benzamide.
| Compound Name | N-(2-amino-1-methoxy-2-oxoethyl)-4-(methoxyiminomethyl)benzamide |
|---|---|
| PubChem CID | 54475671 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-(2-amino-1-methoxy-2-oxoethyl)-4-(methoxyiminomethyl)benzamide |
| SMILES | CON=Cc1ccc(C(=O)NC(OC)C(N)=O)cc1 |
| InChI | InChI=1S/C12H15N3O4/c1-18-12(10(13)16)15-11(17)9-5-3-8(4-6-9)7-14-19-2/h3-7,12H,1-2H3,(H2,13,16)(H,15,17) |
| InChIKey | XLKACMZRCVMZGT-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|