C16H19BrN4O4S — CID 31599101
4-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]carbamoyl]-N-tert-butylbenzenesulfonamide (PubChem CID 31599101) has the molecular formula C16H19BrN4O4S and a molecular weight of 443.32 g/mol. Its IUPAC name is 4-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]carbamoyl]-N-tert-butylbenzenesulfonamide.
| Compound Name | 4-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]carbamoyl]-N-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 31599101 |
| Molecular Formula | C16H19BrN4O4S |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-[[(4-bromo-1H-pyrrole-2-carbonyl)amino]carbamoyl]-N-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)NNC(=O)c2cc(Br)c[nH]2)cc1 |
| InChI | InChI=1S/C16H19BrN4O4S/c1-16(2,3)21-26(24,25)12-6-4-10(5-7-12)14(22)19-20-15(23)13-8-11(17)9-18-13/h4-9,18,21H,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | BBCQJRNATXJNEO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|