C13H12ClN3O4S — CID 34967132
4-chloro-N'-(4-methylsulfonylbenzoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 34967132) has the molecular formula C13H12ClN3O4S and a molecular weight of 341.78 g/mol. Its IUPAC name is 4-chloro-N'-(4-methylsulfonylbenzoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-chloro-N'-(4-methylsulfonylbenzoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 34967132 |
| Molecular Formula | C13H12ClN3O4S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-chloro-N'-(4-methylsulfonylbenzoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NNC(=O)c2cc(Cl)c[nH]2)cc1 |
| InChI | InChI=1S/C13H12ClN3O4S/c1-22(20,21)10-4-2-8(3-5-10)12(18)16-17-13(19)11-6-9(14)7-15-11/h2-7,15H,1H3,(H,16,18)(H,17,19) |
| InChIKey | ZQVFFQGOXDWYDI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|