C13H14ClN3O3S — CID 71929517
4-chloro-N-[2-(methanesulfonamido)-5-methylphenyl]-1H-pyrrole-2-carboxamide (PubChem CID 71929517) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 4-chloro-N-[2-(methanesulfonamido)-5-methylphenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[2-(methanesulfonamido)-5-methylphenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71929517 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 4-chloro-N-[2-(methanesulfonamido)-5-methylphenyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccc(NS(C)(=O)=O)c(NC(=O)c2cc(Cl)c[nH]2)c1 |
| InChI | InChI=1S/C13H14ClN3O3S/c1-8-3-4-10(17-21(2,19)20)11(5-8)16-13(18)12-6-9(14)7-15-12/h3-7,15,17H,1-2H3,(H,16,18) |
| InChIKey | RETZOBOWJARFBQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |