C15H16N2O2 — CID 8867620
4-acetyl-N-(2,5-dimethylphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 8867620) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-acetyl-N-(2,5-dimethylphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-(2,5-dimethylphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8867620 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-acetyl-N-(2,5-dimethylphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c[nH]c(C(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C15H16N2O2/c1-9-4-5-10(2)13(6-9)17-15(19)14-7-12(8-16-14)11(3)18/h4-8,16H,1-3H3,(H,17,19) |
| InChIKey | ZTDFRGAAMBIWEA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |