C13H15N3O — CID 110683959
N-(2,5-dimethylphenyl)-5-methyl-1H-imidazole-4-carboxamide (PubChem CID 110683959) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-5-methyl-1H-imidazole-4-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-5-methyl-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 110683959 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-(2,5-dimethylphenyl)-5-methyl-1H-imidazole-4-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2nc[nH]c2C)c1 |
| InChI | InChI=1S/C13H15N3O/c1-8-4-5-9(2)11(6-8)16-13(17)12-10(3)14-7-15-12/h4-7H,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | URUDXRPDPAXSAK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |