C14H13FN2O — CID 110474800
N-(2,5-dimethylphenyl)-3-fluoropyridine-2-carboxamide (PubChem CID 110474800) has the molecular formula C14H13FN2O and a molecular weight of 244.27 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-fluoropyridine-2-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 110474800 |
| Molecular Formula | C14H13FN2O |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-fluoropyridine-2-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2ncccc2F)c1 |
| InChI | InChI=1S/C14H13FN2O/c1-9-5-6-10(2)12(8-9)17-14(18)13-11(15)4-3-7-16-13/h3-8H,1-2H3,(H,17,18) |
| InChIKey | GHEIMRYHUCFAQP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |