C17H21ClN4O — CID 18127990
4-chloro-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrole-2-carboxamide (PubChem CID 18127990) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 4-chloro-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18127990 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-chloro-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C17H21ClN4O/c1-12-9-14(22-7-5-21(2)6-8-22)3-4-15(12)20-17(23)16-10-13(18)11-19-16/h3-4,9-11,19H,5-8H2,1-2H3,(H,20,23) |
| InChIKey | BFXVQQARKHXIFS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|