C17H19Br2N3OS — CID 36558379
4,5-dibromo-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]thiophene-2-carboxamide (PubChem CID 36558379) has the molecular formula C17H19Br2N3OS and a molecular weight of 473.23 g/mol. Its IUPAC name is 4,5-dibromo-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 36558379 |
| Molecular Formula | C17H19Br2N3OS |
| Molecular Weight | 473.23 g/mol |
| Exact Mass | 470.96 |
| IUPAC Name | 4,5-dibromo-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C17H19Br2N3OS/c1-11-9-12(22-7-5-21(2)6-8-22)3-4-14(11)20-17(23)15-10-13(18)16(19)24-15/h3-4,9-10H,5-8H2,1-2H3,(H,20,23) |
| InChIKey | WZTKCJAKGRMQRY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|