C20H24ClN3O2S — CID 4827584
4-(5-chlorothiophen-2-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-oxobutanamide (PubChem CID 4827584) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-oxobutanamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 4827584 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-oxobutanamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)CCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H24ClN3O2S/c1-14-13-15(24-11-9-23(2)10-12-24)3-4-16(14)22-20(26)8-5-17(25)18-6-7-19(21)27-18/h3-4,6-7,13H,5,8-12H2,1-2H3,(H,22,26) |
| InChIKey | HIIQOSBSGGXRQL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|