C22H26N4OS — CID 43004526
3-(1,3-benzothiazol-2-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide (PubChem CID 43004526) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 43004526 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)CCc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H26N4OS/c1-16-15-17(26-13-11-25(2)12-14-26)7-8-18(16)23-21(27)9-10-22-24-19-5-3-4-6-20(19)28-22/h3-8,15H,9-14H2,1-2H3,(H,23,27) |
| InChIKey | NJAKZJLXUIBKIH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|