C18H18N2OS — CID 7964922
3-(1,3-benzothiazol-2-yl)-N-(2,3-dimethylphenyl)propanamide (PubChem CID 7964922) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-(2,3-dimethylphenyl)propanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-(2,3-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 7964922 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-(2,3-dimethylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCc2nc3ccccc3s2)c1C |
| InChI | InChI=1S/C18H18N2OS/c1-12-6-5-8-14(13(12)2)19-17(21)10-11-18-20-15-7-3-4-9-16(15)22-18/h3-9H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | BJFNCWVRQPLXQF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |