C20H22N2OS — CID 26290774
4-(1,3-benzothiazol-2-yl)-N-(2-propan-2-ylphenyl)butanamide (PubChem CID 26290774) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-(2-propan-2-ylphenyl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-(2-propan-2-ylphenyl)butanamide |
|---|---|
| PubChem CID | 26290774 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-(2-propan-2-ylphenyl)butanamide |
| SMILES | CC(C)c1ccccc1NC(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H22N2OS/c1-14(2)15-8-3-4-9-16(15)21-19(23)12-7-13-20-22-17-10-5-6-11-18(17)24-20/h3-6,8-11,14H,7,12-13H2,1-2H3,(H,21,23) |
| InChIKey | ANLNQCGWPDGPKW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |