C18H16F2N2O3S2 — CID 55340208
4-(1,3-benzothiazol-2-yl)-N-[2-(difluoromethylsulfonyl)phenyl]butanamide (PubChem CID 55340208) has the molecular formula C18H16F2N2O3S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[2-(difluoromethylsulfonyl)phenyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[2-(difluoromethylsulfonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 55340208 |
| Molecular Formula | C18H16F2N2O3S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[2-(difluoromethylsulfonyl)phenyl]butanamide |
| SMILES | O=C(CCCc1nc2ccccc2s1)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C18H16F2N2O3S2/c19-18(20)27(24,25)15-9-4-2-7-13(15)21-16(23)10-5-11-17-22-12-6-1-3-8-14(12)26-17/h1-4,6-9,18H,5,10-11H2,(H,21,23) |
| InChIKey | VBHWAACSPXSYAG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |