C22H25N5O3S — CID 112810322
3-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-N-(2-methyl-4-nitrophenyl)propanamide (PubChem CID 112810322) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-N-(2-methyl-4-nitrophenyl)propanamide.
| Compound Name | 3-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-N-(2-methyl-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 112810322 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-N-(2-methyl-4-nitrophenyl)propanamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CCN1CCN(Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C22H25N5O3S/c1-16-14-17(27(29)30)6-7-18(16)23-21(28)8-9-25-10-12-26(13-11-25)15-22-24-19-4-2-3-5-20(19)31-22/h2-7,14H,8-13,15H2,1H3,(H,23,28) |
| InChIKey | MQVNKSHCKFHKLC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|