C19H30N4O2 — CID 94029173
N'-[(2S)-3-methylbutan-2-yl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide (PubChem CID 94029173) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N'-[(2S)-3-methylbutan-2-yl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide.
| Compound Name | N'-[(2S)-3-methylbutan-2-yl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 94029173 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N'-[(2S)-3-methylbutan-2-yl]-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)C(=O)N[C@@H](C)C(C)C |
| InChI | InChI=1S/C19H30N4O2/c1-13(2)15(4)20-18(24)19(25)21-17-7-6-16(12-14(17)3)23-10-8-22(5)9-11-23/h6-7,12-13,15H,8-11H2,1-5H3,(H,20,24)(H,21,25)/t15-/m0/s1 |
| InChIKey | DQZCRRRWZDKEIS-HNNXBMFYSA-N |
| XLogP | 1.85 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|