C21H24N4OS2 — CID 39966448
4-methyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-thiophen-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 39966448) has the molecular formula C21H24N4OS2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 4-methyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-thiophen-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-thiophen-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39966448 |
| Molecular Formula | C21H24N4OS2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-methyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-thiophen-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)c1sc(-c2cccs2)nc1C |
| InChI | InChI=1S/C21H24N4OS2/c1-14-13-16(25-10-8-24(3)9-11-25)6-7-17(14)23-20(26)19-15(2)22-21(28-19)18-5-4-12-27-18/h4-7,12-13H,8-11H2,1-3H3,(H,23,26) |
| InChIKey | QWYRQXFHRVPULR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|