C12H9Cl2N3O2 — CID 18106742
4-chloro-N'-(4-chlorobenzoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 18106742) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is 4-chloro-N'-(4-chlorobenzoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-chloro-N'-(4-chlorobenzoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 18106742 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 4-chloro-N'-(4-chlorobenzoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(Cl)c[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9Cl2N3O2/c13-8-3-1-7(2-4-8)11(18)16-17-12(19)10-5-9(14)6-15-10/h1-6,15H,(H,16,18)(H,17,19) |
| InChIKey | RYFJKQBDDWPBQN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|