C12H9ClN2O3 — CID 28741856
3-[(4-chloro-1H-pyrrole-2-carbonyl)amino]benzoic acid (PubChem CID 28741856) has the molecular formula C12H9ClN2O3 and a molecular weight of 264.67 g/mol. Its IUPAC name is 3-[(4-chloro-1H-pyrrole-2-carbonyl)amino]benzoic acid.
| Compound Name | 3-[(4-chloro-1H-pyrrole-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 28741856 |
| Molecular Formula | C12H9ClN2O3 |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 3-[(4-chloro-1H-pyrrole-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2cc(Cl)c[nH]2)c1 |
| InChI | InChI=1S/C12H9ClN2O3/c13-8-5-10(14-6-8)11(16)15-9-3-1-2-7(4-9)12(17)18/h1-6,14H,(H,15,16)(H,17,18) |
| InChIKey | RMRNLQRZRRBODL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |