C12H7ClF2N2O3 — CID 62867657
2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4,5-difluorobenzoic acid (PubChem CID 62867657) has the molecular formula C12H7ClF2N2O3 and a molecular weight of 300.65 g/mol. Its IUPAC name is 2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4,5-difluorobenzoic acid.
| Compound Name | 2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 62867657 |
| Molecular Formula | C12H7ClF2N2O3 |
| Molecular Weight | 300.65 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4,5-difluorobenzoic acid |
| SMILES | O=C(Nc1cc(F)c(F)cc1C(=O)O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C12H7ClF2N2O3/c13-5-1-10(16-4-5)11(18)17-9-3-8(15)7(14)2-6(9)12(19)20/h1-4,16H,(H,17,18)(H,19,20) |
| InChIKey | GXLGBRKNKGSMRF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.65 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |