C14H10Cl2N2O2 — CID 81262734
4-chloro-N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrrole-2-carboxamide (PubChem CID 81262734) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 4-chloro-N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 81262734 |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 4-chloro-N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C#CCO)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C14H10Cl2N2O2/c15-10-3-4-12(9(6-10)2-1-5-19)18-14(20)13-7-11(16)8-17-13/h3-4,6-8,17,19H,5H2,(H,18,20) |
| InChIKey | IITQVJVENLGFFF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|