C13H10ClN3O3 — CID 81262739
N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide (PubChem CID 81262739) has the molecular formula C13H10ClN3O3 and a molecular weight of 291.69 g/mol. Its IUPAC name is N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 81262739 |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C#CCO)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C13H10ClN3O3/c14-9-3-4-10(8(6-9)2-1-5-18)16-12(19)11-7-15-13(20)17-11/h3-4,6-7,18H,5H2,(H,16,19)(H2,15,17,20) |
| InChIKey | SCHFRVAFUVRBLF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|