C15H12Cl2N2O2 — CID 60805065
4,5-dichloro-N-[2-(3-hydroxyprop-1-ynyl)-4-methylphenyl]-1H-pyrrole-2-carboxamide (PubChem CID 60805065) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 4,5-dichloro-N-[2-(3-hydroxyprop-1-ynyl)-4-methylphenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-[2-(3-hydroxyprop-1-ynyl)-4-methylphenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60805065 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 4,5-dichloro-N-[2-(3-hydroxyprop-1-ynyl)-4-methylphenyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Cl)c(Cl)[nH]2)c(C#CCO)c1 |
| InChI | InChI=1S/C15H12Cl2N2O2/c1-9-4-5-12(10(7-9)3-2-6-20)19-15(21)13-8-11(16)14(17)18-13/h4-5,7-8,18,20H,6H2,1H3,(H,19,21) |
| InChIKey | IALSUDHBBXSOOE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|