C11H8Cl2N2O2 — CID 64787118
4-chloro-N-(4-chloro-3-hydroxyphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 64787118) has the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. Its IUPAC name is 4-chloro-N-(4-chloro-3-hydroxyphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(4-chloro-3-hydroxyphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 64787118 |
| Molecular Formula | C11H8Cl2N2O2 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 4-chloro-N-(4-chloro-3-hydroxyphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(O)c1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C11H8Cl2N2O2/c12-6-3-9(14-5-6)11(17)15-7-1-2-8(13)10(16)4-7/h1-5,14,16H,(H,15,17) |
| InChIKey | ZGKYDDRKFUMOOE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |