C11H7Cl3N2O2 — CID 64787518
4,5-dichloro-N-(3-chloro-4-hydroxyphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 64787518) has the molecular formula C11H7Cl3N2O2 and a molecular weight of 305.55 g/mol. Its IUPAC name is 4,5-dichloro-N-(3-chloro-4-hydroxyphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(3-chloro-4-hydroxyphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 64787518 |
| Molecular Formula | C11H7Cl3N2O2 |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | 4,5-dichloro-N-(3-chloro-4-hydroxyphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C11H7Cl3N2O2/c12-6-3-5(1-2-9(6)17)15-11(18)8-4-7(13)10(14)16-8/h1-4,16-17H,(H,15,18) |
| InChIKey | IHPQKHZYSCJIDO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|