C11H7Cl2IN2O — CID 31301419
4,5-dichloro-N-(2-iodophenyl)-1H-pyrrole-2-carboxamide (PubChem CID 31301419) has the molecular formula C11H7Cl2IN2O and a molecular weight of 381.00 g/mol. Its IUPAC name is 4,5-dichloro-N-(2-iodophenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(2-iodophenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 31301419 |
| Molecular Formula | C11H7Cl2IN2O |
| Molecular Weight | 381.00 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | 4,5-dichloro-N-(2-iodophenyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1I)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C11H7Cl2IN2O/c12-6-5-9(15-10(6)13)11(17)16-8-4-2-1-3-7(8)14/h1-5,15H,(H,16,17) |
| InChIKey | ZCGUSERVWRBSSG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.00 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|