C11H6BrCl2FN2O — CID 43134338
N-(2-bromo-4-fluorophenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide (PubChem CID 43134338) has the molecular formula C11H6BrCl2FN2O and a molecular weight of 351.99 g/mol. Its IUPAC name is N-(2-bromo-4-fluorophenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2-bromo-4-fluorophenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43134338 |
| Molecular Formula | C11H6BrCl2FN2O |
| Molecular Weight | 351.99 g/mol |
| Exact Mass | 349.90 |
| IUPAC Name | N-(2-bromo-4-fluorophenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1Br)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C11H6BrCl2FN2O/c12-6-3-5(15)1-2-8(6)17-11(18)9-4-7(13)10(14)16-9/h1-4,16H,(H,17,18) |
| InChIKey | AAEQQJXNMHRTPW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.99 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |