C12H6Cl2F2N2O3 — CID 60828597
5-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-2,4-difluorobenzoic acid (PubChem CID 60828597) has the molecular formula C12H6Cl2F2N2O3 and a molecular weight of 335.09 g/mol. Its IUPAC name is 5-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 60828597 |
| Molecular Formula | C12H6Cl2F2N2O3 |
| Molecular Weight | 335.09 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 5-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-2,4-difluorobenzoic acid |
| SMILES | O=C(Nc1cc(C(=O)O)c(F)cc1F)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C12H6Cl2F2N2O3/c13-5-2-9(17-10(5)14)11(19)18-8-1-4(12(20)21)6(15)3-7(8)16/h1-3,17H,(H,18,19)(H,20,21) |
| InChIKey | PKFIYGIKDWEBKT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.09 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |