C12H9F2N3O3S — CID 60748340
5-[(4-ethylthiadiazole-5-carbonyl)amino]-2,4-difluorobenzoic acid (PubChem CID 60748340) has the molecular formula C12H9F2N3O3S and a molecular weight of 313.29 g/mol. Its IUPAC name is 5-[(4-ethylthiadiazole-5-carbonyl)amino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[(4-ethylthiadiazole-5-carbonyl)amino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 60748340 |
| Molecular Formula | C12H9F2N3O3S |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 5-[(4-ethylthiadiazole-5-carbonyl)amino]-2,4-difluorobenzoic acid |
| SMILES | CCc1nnsc1C(=O)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C12H9F2N3O3S/c1-2-8-10(21-17-16-8)11(18)15-9-3-5(12(19)20)6(13)4-7(9)14/h3-4H,2H2,1H3,(H,15,18)(H,19,20) |
| InChIKey | IIIVQMGJYUAVAH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |