C12H9FN4OS — CID 79953365
N-(2-cyano-4-fluorophenyl)-4-ethylthiadiazole-5-carboxamide (PubChem CID 79953365) has the molecular formula C12H9FN4OS and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(2-cyano-4-fluorophenyl)-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-(2-cyano-4-fluorophenyl)-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 79953365 |
| Molecular Formula | C12H9FN4OS |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | N-(2-cyano-4-fluorophenyl)-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1ccc(F)cc1C#N |
| InChI | InChI=1S/C12H9FN4OS/c1-2-9-11(19-17-16-9)12(18)15-10-4-3-8(13)5-7(10)6-14/h3-5H,2H2,1H3,(H,15,18) |
| InChIKey | IPZDNRQQLMYNJR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |