C13H10Cl2N2O4 — CID 115410909
2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-5-methoxybenzoic acid (PubChem CID 115410909) has the molecular formula C13H10Cl2N2O4 and a molecular weight of 329.14 g/mol. Its IUPAC name is 2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-5-methoxybenzoic acid.
| Compound Name | 2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 115410909 |
| Molecular Formula | C13H10Cl2N2O4 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(NC(=O)c2cc(Cl)c(Cl)[nH]2)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H10Cl2N2O4/c1-21-6-2-3-9(7(4-6)13(19)20)17-12(18)10-5-8(14)11(15)16-10/h2-5,16H,1H3,(H,17,18)(H,19,20) |
| InChIKey | LJCIWVYFCPADPP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |